C26H29N7O4 — CID 123869820
tert-butyl (1S,4S)-5-[4-[6-[(4-methyl-2-pyridinyl)amino]-4-nitro-2-pyridinyl]-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 123869820) has the molecular formula C26H29N7O4 and a molecular weight of 503.56 g/mol. Its IUPAC name is tert-butyl (1S,4S)-5-[4-[6-[(4-methyl-2-pyridinyl)amino]-4-nitro-2-pyridinyl]-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl (1S,4S)-5-[4-[6-[(4-methyl-2-pyridinyl)amino]-4-nitro-2-pyridinyl]-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 123869820 |
| Molecular Formula | C26H29N7O4 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | tert-butyl (1S,4S)-5-[4-[6-[(4-methyl-2-pyridinyl)amino]-4-nitro-2-pyridinyl]-2-pyridinyl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | Cc1ccnc(Nc2cc([N+](=O)[O-])cc(-c3ccnc(N4C[C@@H]5C[C@H]4CN5C(=O)OC(C)(C)C)c3)n2)c1 |
| InChI | InChI=1S/C26H29N7O4/c1-16-5-7-27-22(9-16)30-23-13-18(33(35)36)12-21(29-23)17-6-8-28-24(10-17)31-14-20-11-19(31)15-32(20)25(34)37-26(2,3)4/h5-10,12-13,19-20H,11,14-15H2,1-4H3,(H,27,29,30)/t19-,20-/m0/s1 |
| InChIKey | GESJGVSYEOSBHY-PMACEKPBSA-N |
| XLogP | 4.70 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|