C43H78 — CID 123869913
9,10-dimethylidene-2-(3,7,8,8-tetramethyldecan-3-yl)-6-(3,7,8,8-tetramethylnonan-3-yl)-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene (PubChem CID 123869913) has the molecular formula C43H78 and a molecular weight of 595.10 g/mol. Its IUPAC name is 9,10-dimethylidene-2-(3,7,8,8-tetramethyldecan-3-yl)-6-(3,7,8,8-tetramethylnonan-3-yl)-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene.
| Compound Name | 9,10-dimethylidene-2-(3,7,8,8-tetramethyldecan-3-yl)-6-(3,7,8,8-tetramethylnonan-3-yl)-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene |
|---|---|
| PubChem CID | 123869913 |
| Molecular Formula | C43H78 |
| Molecular Weight | 595.10 g/mol |
| Exact Mass | 594.61 |
| IUPAC Name | 9,10-dimethylidene-2-(3,7,8,8-tetramethyldecan-3-yl)-6-(3,7,8,8-tetramethylnonan-3-yl)-1,2,3,4,4a,5,6,7,8,8a,9a,10a-dodecahydroanthracene |
| SMILES | C=C1C2CCC(C(C)(CC)CCCC(C)C(C)(C)CC)CC2C(=C)C2CCC(C(C)(CC)CCCC(C)C(C)(C)C)CC12 |
| InChI | InChI=1S/C43H78/c1-15-41(11,12)31(5)21-19-27-43(14,17-3)35-23-25-37-32(6)38-28-34(22-24-36(38)33(7)39(37)29-35)42(13,16-2)26-18-20-30(4)40(8,9)10/h30-31,34-39H,6-7,15-29H2,1-5,8-14H3 |
| InChIKey | BCLOHGBHFQHUDV-UHFFFAOYSA-N |
| XLogP | 14.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.10 |
| LogP ≤ 5 | 14.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|