C11H14N2S — CID 123869938
4-methyl-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidine (PubChem CID 123869938) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 4-methyl-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidine.
| Compound Name | 4-methyl-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 123869938 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4-methyl-4b,5,6,7,8,8a-hexahydro-[1]benzothiolo[2,3-d]pyrimidine |
| SMILES | Cc1ncnc2c1C1CCCCC1S2 |
| InChI | InChI=1S/C11H14N2S/c1-7-10-8-4-2-3-5-9(8)14-11(10)13-6-12-7/h6,8-9H,2-5H2,1H3 |
| InChIKey | QVGDWJYKPBDJIL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |