C17H23NO — CID 123870105
(4E,7Z,9Z)-3-methanimidoyl-5,8-dimethyl-6-methylidenetrideca-4,7,9,12-tetraen-2-one (PubChem CID 123870105) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (4E,7Z,9Z)-3-methanimidoyl-5,8-dimethyl-6-methylidenetrideca-4,7,9,12-tetraen-2-one.
| Compound Name | (4E,7Z,9Z)-3-methanimidoyl-5,8-dimethyl-6-methylidenetrideca-4,7,9,12-tetraen-2-one |
|---|---|
| PubChem CID | 123870105 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (4E,7Z,9Z)-3-methanimidoyl-5,8-dimethyl-6-methylidenetrideca-4,7,9,12-tetraen-2-one |
| SMILES | [H]/N=C/C(/C=C(\C)C(=C)/C=C(C)\C=C/CC=C)C(C)=O |
| InChI | InChI=1S/C17H23NO/c1-6-7-8-9-13(2)10-14(3)15(4)11-17(12-18)16(5)19/h6,8-12,17-18H,1,3,7H2,2,4-5H3/b9-8-,13-10-,15-11+,18-12+ |
| InChIKey | OYOVWVTZXOFWFV-KNJYREFDSA-N |
| XLogP | 4.42 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|