About CID 123870364
CID 123870364 (PubChem CID 123870364) has the molecular formula C45H34BN2O3S
and a molecular weight of 693.66 g/mol.
Molecular Properties
| Compound Name | CID 123870364 |
| PubChem CID | 123870364 |
| Molecular Formula | C45H34BN2O3S |
| Molecular Weight | 693.66 g/mol |
| Exact Mass | 693.24 |
| IUPAC Name | — |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(C3=CC=C(c4ccc(-c5ccc(-c6nc7cc(C)ccc7s6)cc5)cc4C=O)[B]3)cc2)cc1 |
| InChI | InChI=1S/C45H34BN2O3S/c1-29-4-25-44-43(26-29)47-45(52-44)32-7-5-30(6-8-32)33-11-22-40(34(27-33)28-49)42-24-23-41(46-42)31-9-12-35(13-10-31)48(36-14-18-38(50-2)19-15-36)37-16-20-39(51-3)21-17-37/h4-28H,1-3H3 |
| InChIKey | GEGFSBQUUAYBHV-UHFFFAOYSA-N |
| XLogP | 11.34 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 693.66 |
| LogP ≤ 5 | 11.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 123870364 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123870364?
The IUPAC name of CID 123870364 (CID 123870364) is not available.
What is the SMILES notation for CID 123870364?
The canonical SMILES for CID 123870364 is COc1ccc(N(c2ccc(OC)cc2)c2ccc(C3=CC=C(c4ccc(-c5ccc(-c6nc7cc(C)ccc7s6)cc5)cc4C=O)[B]3)cc2)cc1.
What is the InChIKey of CID 123870364?
The InChIKey is GEGFSBQUUAYBHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C45H34BN2O3S/c1-29-4-25-44-43(26-29)47-45(52-44)32-7-5-30(6-8-32)33-11-22-40(34(27-33)28-49)42-24-23-41(46-42)31-9-12-35(13-10-31)48(36-14-18-38(50-2)19-15-36)37-16-20-39(51-3)21-17-37/h4-28H,1-3H3.
What are the key properties of CID 123870364?
CID 123870364 has a molecular weight of 693.66 g/mol, XLogP of 11.34, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123870364 is sourced from PubChem (CID 123870364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).