C10H13NO2 — CID 123870394
2-methoxy-3,6,7,8-tetrahydro-2H-quinolin-5-one (PubChem CID 123870394) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-methoxy-3,6,7,8-tetrahydro-2H-quinolin-5-one.
| Compound Name | 2-methoxy-3,6,7,8-tetrahydro-2H-quinolin-5-one |
|---|---|
| PubChem CID | 123870394 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-methoxy-3,6,7,8-tetrahydro-2H-quinolin-5-one |
| SMILES | COC1CC=C2C(=O)CCCC2=N1 |
| InChI | InChI=1S/C10H13NO2/c1-13-10-6-5-7-8(11-10)3-2-4-9(7)12/h5,10H,2-4,6H2,1H3 |
| InChIKey | SVIYZKUROHBIAG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |