C20H37N5 — CID 123870776
2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,21,22,23,24-docosahydro-1H-corrin-5-ylmethanamine (PubChem CID 123870776) has the molecular formula C20H37N5 and a molecular weight of 347.55 g/mol. Its IUPAC name is 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,21,22,23,24-docosahydro-1H-corrin-5-ylmethanamine.
| Compound Name | 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,21,22,23,24-docosahydro-1H-corrin-5-ylmethanamine |
|---|---|
| PubChem CID | 123870776 |
| Molecular Formula | C20H37N5 |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.30 |
| IUPAC Name | 2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,21,22,23,24-docosahydro-1H-corrin-5-ylmethanamine |
| SMILES | NCC1C2CCC(CC3CCC(CC4CCC(N4)C4CCC1N4)N3)N2 |
| InChI | InChI=1S/C20H37N5/c21-11-16-17-5-3-14(23-17)9-12-1-2-13(22-12)10-15-4-6-19(24-15)20-8-7-18(16)25-20/h12-20,22-25H,1-11,21H2 |
| InChIKey | IBJXEVQTBMYTNS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |