About 5-[2-(aminomethyl)-3-fluoroprop-2-enoxy]-N,N-diethyl-2-methylhexa-2,4-dienamide
5-[2-(aminomethyl)-3-fluoroprop-2-enoxy]-N,N-diethyl-2-methylhexa-2,4-dienamide (PubChem CID 123872335) has the molecular formula C15H25FN2O2
and a molecular weight of 284.38 g/mol. Its IUPAC name is 5-[2-(aminomethyl)-3-fluoroprop-2-enoxy]-N,N-diethyl-2-methylhexa-2,4-dienamide.
Molecular Properties
| Compound Name | 5-[2-(aminomethyl)-3-fluoroprop-2-enoxy]-N,N-diethyl-2-methylhexa-2,4-dienamide |
| PubChem CID | 123872335 |
| Molecular Formula | C15H25FN2O2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 5-[2-(aminomethyl)-3-fluoroprop-2-enoxy]-N,N-diethyl-2-methylhexa-2,4-dienamide |
| SMILES | CCN(CC)C(=O)C(C)=CC=C(C)OCC(=CF)CN |
| InChI | InChI=1S/C15H25FN2O2/c1-5-18(6-2)15(19)12(3)7-8-13(4)20-11-14(9-16)10-17/h7-9H,5-6,10-11,17H2,1-4H3 |
| InChIKey | HUWNORMLUCIJDB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(aminomethyl)-3-fluoroprop-2-enoxy]-N,N-diethyl-2-methylhexa-2,4-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(aminomethyl)-3-fluoroprop-2-enoxy]-N,N-diethyl-2-methylhexa-2,4-dienamide?
The IUPAC name of 5-[2-(aminomethyl)-3-fluoroprop-2-enoxy]-N,N-diethyl-2-methylhexa-2,4-dienamide (CID 123872335) is 5-[2-(aminomethyl)-3-fluoroprop-2-enoxy]-N,N-diethyl-2-methylhexa-2,4-dienamide.
What is the SMILES notation for 5-[2-(aminomethyl)-3-fluoroprop-2-enoxy]-N,N-diethyl-2-methylhexa-2,4-dienamide?
The canonical SMILES for 5-[2-(aminomethyl)-3-fluoroprop-2-enoxy]-N,N-diethyl-2-methylhexa-2,4-dienamide is CCN(CC)C(=O)C(C)=CC=C(C)OCC(=CF)CN.
What is the InChIKey of 5-[2-(aminomethyl)-3-fluoroprop-2-enoxy]-N,N-diethyl-2-methylhexa-2,4-dienamide?
The InChIKey is HUWNORMLUCIJDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25FN2O2/c1-5-18(6-2)15(19)12(3)7-8-13(4)20-11-14(9-16)10-17/h7-9H,5-6,10-11,17H2,1-4H3.
What are the key properties of 5-[2-(aminomethyl)-3-fluoroprop-2-enoxy]-N,N-diethyl-2-methylhexa-2,4-dienamide?
5-[2-(aminomethyl)-3-fluoroprop-2-enoxy]-N,N-diethyl-2-methylhexa-2,4-dienamide has a molecular weight of 284.38 g/mol, XLogP of 2.53, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(aminomethyl)-3-fluoroprop-2-enoxy]-N,N-diethyl-2-methylhexa-2,4-dienamide is sourced from PubChem (CID 123872335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).