C18H17N3O6S — CID 123872898
phenyl N-[2-[[3-[hydroxy(methylamino)methyl]-4,7-dioxo-1,2-benzoxazol-5-yl]sulfanyl]ethyl]carbamate (PubChem CID 123872898) has the molecular formula C18H17N3O6S and a molecular weight of 403.42 g/mol. Its IUPAC name is phenyl N-[2-[[3-[hydroxy(methylamino)methyl]-4,7-dioxo-1,2-benzoxazol-5-yl]sulfanyl]ethyl]carbamate.
| Compound Name | phenyl N-[2-[[3-[hydroxy(methylamino)methyl]-4,7-dioxo-1,2-benzoxazol-5-yl]sulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 123872898 |
| Molecular Formula | C18H17N3O6S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | phenyl N-[2-[[3-[hydroxy(methylamino)methyl]-4,7-dioxo-1,2-benzoxazol-5-yl]sulfanyl]ethyl]carbamate |
| SMILES | CNC(O)c1noc2c1C(=O)C(SCCNC(=O)Oc1ccccc1)=CC2=O |
| InChI | InChI=1S/C18H17N3O6S/c1-19-17(24)14-13-15(23)12(9-11(22)16(13)27-21-14)28-8-7-20-18(25)26-10-5-3-2-4-6-10/h2-6,9,17,19,24H,7-8H2,1H3,(H,20,25) |
| InChIKey | RIZKRQGFYINZKR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|