C20H20N3O5+ — CID 123872967
[2-ethoxy-5-[3-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-1,2,4-oxadiazol-5-yl]phenyl]-methoxy-oxoazanium (PubChem CID 123872967) has the molecular formula C20H20N3O5+ and a molecular weight of 382.40 g/mol. Its IUPAC name is [2-ethoxy-5-[3-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-1,2,4-oxadiazol-5-yl]phenyl]-methoxy-oxoazanium.
| Compound Name | [2-ethoxy-5-[3-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-1,2,4-oxadiazol-5-yl]phenyl]-methoxy-oxoazanium |
|---|---|
| PubChem CID | 123872967 |
| Molecular Formula | C20H20N3O5+ |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | [2-ethoxy-5-[3-(1-hydroxy-2,3-dihydro-1H-inden-4-yl)-1,2,4-oxadiazol-5-yl]phenyl]-methoxy-oxoazanium |
| SMILES | CCOc1ccc(-c2nc(-c3cccc4c3CCC4O)no2)cc1[N+](=O)OC |
| InChI | InChI=1S/C20H20N3O5/c1-3-27-18-10-7-12(11-16(18)23(25)26-2)20-21-19(22-28-20)15-6-4-5-14-13(15)8-9-17(14)24/h4-7,10-11,17,24H,3,8-9H2,1-2H3/q+1 |
| InChIKey | WNBUMCFHFHMWKH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|