About (5Z,7E)-8-fluoro-3-methylnona-5,7-dien-4-imine
(5Z,7E)-8-fluoro-3-methylnona-5,7-dien-4-imine (PubChem CID 123873008) has the molecular formula C10H16FN
and a molecular weight of 169.24 g/mol. Its IUPAC name is (5Z,7E)-8-fluoro-3-methylnona-5,7-dien-4-imine.
Molecular Properties
| Compound Name | (5Z,7E)-8-fluoro-3-methylnona-5,7-dien-4-imine |
| PubChem CID | 123873008 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | (5Z,7E)-8-fluoro-3-methylnona-5,7-dien-4-imine |
| SMILES | CCC(C)C(=N)/C=C\C=C(/C)\F |
| InChI | InChI=1S/C10H16FN/c1-4-8(2)10(12)7-5-6-9(3)11/h5-8,12H,4H2,1-3H3/b7-5-,9-6+,12-10? |
| InChIKey | PBWAKNBCKMLNAH-NIIVSZLLSA-N |
| XLogP | 2.80 |
| TPSA | 23.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | 204 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z,7E)-8-fluoro-3-methylnona-5,7-dien-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,7E)-8-fluoro-3-methylnona-5,7-dien-4-imine?
The IUPAC name of (5Z,7E)-8-fluoro-3-methylnona-5,7-dien-4-imine (CID 123873008) is (5Z,7E)-8-fluoro-3-methylnona-5,7-dien-4-imine.
What is the SMILES notation for (5Z,7E)-8-fluoro-3-methylnona-5,7-dien-4-imine?
The canonical SMILES for (5Z,7E)-8-fluoro-3-methylnona-5,7-dien-4-imine is CCC(C)C(=N)/C=C\C=C(/C)\F.
What is the InChIKey of (5Z,7E)-8-fluoro-3-methylnona-5,7-dien-4-imine?
The InChIKey is PBWAKNBCKMLNAH-NIIVSZLLSA-N. The full InChI is InChI=1S/C10H16FN/c1-4-8(2)10(12)7-5-6-9(3)11/h5-8,12H,4H2,1-3H3/b7-5-,9-6+,12-10?.
What are the key properties of (5Z,7E)-8-fluoro-3-methylnona-5,7-dien-4-imine?
(5Z,7E)-8-fluoro-3-methylnona-5,7-dien-4-imine has a molecular weight of 169.24 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,7E)-8-fluoro-3-methylnona-5,7-dien-4-imine is sourced from PubChem (CID 123873008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).