C24H44FO7PS2 — CID 123873017
S-[4-[4-(2,2-dimethylpropanoylsulfanyl)butoxy-[(2-fluoro-4-methyloxolan-2-yl)methoxy]phosphoryl]oxybutyl] 2,2-dimethylpropanethioate (PubChem CID 123873017) has the molecular formula C24H44FO7PS2 and a molecular weight of 558.72 g/mol. Its IUPAC name is S-[4-[4-(2,2-dimethylpropanoylsulfanyl)butoxy-[(2-fluoro-4-methyloxolan-2-yl)methoxy]phosphoryl]oxybutyl] 2,2-dimethylpropanethioate.
| Compound Name | S-[4-[4-(2,2-dimethylpropanoylsulfanyl)butoxy-[(2-fluoro-4-methyloxolan-2-yl)methoxy]phosphoryl]oxybutyl] 2,2-dimethylpropanethioate |
|---|---|
| PubChem CID | 123873017 |
| Molecular Formula | C24H44FO7PS2 |
| Molecular Weight | 558.72 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | S-[4-[4-(2,2-dimethylpropanoylsulfanyl)butoxy-[(2-fluoro-4-methyloxolan-2-yl)methoxy]phosphoryl]oxybutyl] 2,2-dimethylpropanethioate |
| SMILES | CC1COC(F)(COP(=O)(OCCCCSC(=O)C(C)(C)C)OCCCCSC(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C24H44FO7PS2/c1-19-16-24(25,29-17-19)18-32-33(28,30-12-8-10-14-34-20(26)22(2,3)4)31-13-9-11-15-35-21(27)23(5,6)7/h19H,8-18H2,1-7H3 |
| InChIKey | PSNYJCOAZBVTTG-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.72 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|