About N-methyl-2,6-diphenylaniline
N-methyl-2,6-diphenylaniline (PubChem CID 123873033) has the molecular formula C19H17N
and a molecular weight of 259.35 g/mol. Its IUPAC name is N-methyl-2,6-diphenylaniline.
Molecular Properties
| Compound Name | N-methyl-2,6-diphenylaniline |
| PubChem CID | 123873033 |
| Molecular Formula | C19H17N |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | N-methyl-2,6-diphenylaniline |
| SMILES | CNc1c(-c2ccccc2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C19H17N/c1-20-19-17(15-9-4-2-5-10-15)13-8-14-18(19)16-11-6-3-7-12-16/h2-14,20H,1H3 |
| InChIKey | KYTBPFNZMGOCJL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-2,6-diphenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2,6-diphenylaniline?
The IUPAC name of N-methyl-2,6-diphenylaniline (CID 123873033) is N-methyl-2,6-diphenylaniline.
What is the SMILES notation for N-methyl-2,6-diphenylaniline?
The canonical SMILES for N-methyl-2,6-diphenylaniline is CNc1c(-c2ccccc2)cccc1-c1ccccc1.
What is the InChIKey of N-methyl-2,6-diphenylaniline?
The InChIKey is KYTBPFNZMGOCJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N/c1-20-19-17(15-9-4-2-5-10-15)13-8-14-18(19)16-11-6-3-7-12-16/h2-14,20H,1H3.
What are the key properties of N-methyl-2,6-diphenylaniline?
N-methyl-2,6-diphenylaniline has a molecular weight of 259.35 g/mol, XLogP of 5.06, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2,6-diphenylaniline is sourced from PubChem (CID 123873033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).