C19H24N2O5 — CID 123873314
3-[[2-[3-methylidene-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]acetyl]amino]benzoic acid (PubChem CID 123873314) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is 3-[[2-[3-methylidene-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]acetyl]amino]benzoic acid.
| Compound Name | 3-[[2-[3-methylidene-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 123873314 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 3-[[2-[3-methylidene-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]acetyl]amino]benzoic acid |
| SMILES | C=C1CCN(C(=O)OC(C)(C)C)C1CC(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C19H24N2O5/c1-12-8-9-21(18(25)26-19(2,3)4)15(12)11-16(22)20-14-7-5-6-13(10-14)17(23)24/h5-7,10,15H,1,8-9,11H2,2-4H3,(H,20,22)(H,23,24) |
| InChIKey | AIXAMBCTLUXURD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|