About 3-methoxy-2,4-dimethyl-1-methylsulfanylpenta-1,3-diene
3-methoxy-2,4-dimethyl-1-methylsulfanylpenta-1,3-diene (PubChem CID 123874128) has the molecular formula C9H16OS
and a molecular weight of 172.29 g/mol. Its IUPAC name is 3-methoxy-2,4-dimethyl-1-methylsulfanylpenta-1,3-diene.
Molecular Properties
| Compound Name | 3-methoxy-2,4-dimethyl-1-methylsulfanylpenta-1,3-diene |
| PubChem CID | 123874128 |
| Molecular Formula | C9H16OS |
| Molecular Weight | 172.29 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 3-methoxy-2,4-dimethyl-1-methylsulfanylpenta-1,3-diene |
| SMILES | COC(C(C)=CSC)=C(C)C |
| InChI | InChI=1S/C9H16OS/c1-7(2)9(10-4)8(3)6-11-5/h6H,1-5H3 |
| InChIKey | VYKDWLKHJCLIQS-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-2,4-dimethyl-1-methylsulfanylpenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2,4-dimethyl-1-methylsulfanylpenta-1,3-diene?
The IUPAC name of 3-methoxy-2,4-dimethyl-1-methylsulfanylpenta-1,3-diene (CID 123874128) is 3-methoxy-2,4-dimethyl-1-methylsulfanylpenta-1,3-diene.
What is the SMILES notation for 3-methoxy-2,4-dimethyl-1-methylsulfanylpenta-1,3-diene?
The canonical SMILES for 3-methoxy-2,4-dimethyl-1-methylsulfanylpenta-1,3-diene is COC(C(C)=CSC)=C(C)C.
What is the InChIKey of 3-methoxy-2,4-dimethyl-1-methylsulfanylpenta-1,3-diene?
The InChIKey is VYKDWLKHJCLIQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16OS/c1-7(2)9(10-4)8(3)6-11-5/h6H,1-5H3.
What are the key properties of 3-methoxy-2,4-dimethyl-1-methylsulfanylpenta-1,3-diene?
3-methoxy-2,4-dimethyl-1-methylsulfanylpenta-1,3-diene has a molecular weight of 172.29 g/mol, XLogP of 3.19, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2,4-dimethyl-1-methylsulfanylpenta-1,3-diene is sourced from PubChem (CID 123874128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).