About 1-buta-1,3-dien-2-yl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine
1-buta-1,3-dien-2-yl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine (PubChem CID 123874356) has the molecular formula C13H18FN
and a molecular weight of 207.29 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine.
Molecular Properties
| Compound Name | 1-buta-1,3-dien-2-yl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine |
| PubChem CID | 123874356 |
| Molecular Formula | C13H18FN |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 1-buta-1,3-dien-2-yl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine |
| SMILES | C=CC(=C)N1CCCC1C(C)=CC(=C)F |
| InChI | InChI=1S/C13H18FN/c1-5-12(4)15-8-6-7-13(15)10(2)9-11(3)14/h5,9,13H,1,3-4,6-8H2,2H3 |
| InChIKey | NNFOIAMOQBRZMR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-buta-1,3-dien-2-yl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-buta-1,3-dien-2-yl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine?
The IUPAC name of 1-buta-1,3-dien-2-yl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine (CID 123874356) is 1-buta-1,3-dien-2-yl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine.
What is the SMILES notation for 1-buta-1,3-dien-2-yl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine?
The canonical SMILES for 1-buta-1,3-dien-2-yl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine is C=CC(=C)N1CCCC1C(C)=CC(=C)F.
What is the InChIKey of 1-buta-1,3-dien-2-yl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine?
The InChIKey is NNFOIAMOQBRZMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FN/c1-5-12(4)15-8-6-7-13(15)10(2)9-11(3)14/h5,9,13H,1,3-4,6-8H2,2H3.
What are the key properties of 1-buta-1,3-dien-2-yl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine?
1-buta-1,3-dien-2-yl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine has a molecular weight of 207.29 g/mol, XLogP of 3.58, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-buta-1,3-dien-2-yl-2-(4-fluoropenta-2,4-dien-2-yl)pyrrolidine is sourced from PubChem (CID 123874356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).