C16H16F4N2O — CID 123874401
5-(3-fluorophenyl)-4-(trifluoromethyl)-2,3,4a,7,8,9-hexahydropyrido[3,2-c]azepin-4-ol (PubChem CID 123874401) has the molecular formula C16H16F4N2O and a molecular weight of 328.31 g/mol. Its IUPAC name is 5-(3-fluorophenyl)-4-(trifluoromethyl)-2,3,4a,7,8,9-hexahydropyrido[3,2-c]azepin-4-ol.
| Compound Name | 5-(3-fluorophenyl)-4-(trifluoromethyl)-2,3,4a,7,8,9-hexahydropyrido[3,2-c]azepin-4-ol |
|---|---|
| PubChem CID | 123874401 |
| Molecular Formula | C16H16F4N2O |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 5-(3-fluorophenyl)-4-(trifluoromethyl)-2,3,4a,7,8,9-hexahydropyrido[3,2-c]azepin-4-ol |
| SMILES | OC1(C(F)(F)F)CCN=C2CCCN=C(c3cccc(F)c3)C21 |
| InChI | InChI=1S/C16H16F4N2O/c17-11-4-1-3-10(9-11)14-13-12(5-2-7-22-14)21-8-6-15(13,23)16(18,19)20/h1,3-4,9,13,23H,2,5-8H2 |
| InChIKey | YPLOBODJEDQLMN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |