About N-ethenyl-N',1-dimethylcyclopropane-1-carboximidamide
N-ethenyl-N',1-dimethylcyclopropane-1-carboximidamide (PubChem CID 123875368) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is N-ethenyl-N',1-dimethylcyclopropane-1-carboximidamide.
Molecular Properties
| Compound Name | N-ethenyl-N',1-dimethylcyclopropane-1-carboximidamide |
| PubChem CID | 123875368 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N-ethenyl-N',1-dimethylcyclopropane-1-carboximidamide |
| SMILES | C=CN/C(=N\C)C1(C)CC1 |
| InChI | InChI=1S/C8H14N2/c1-4-10-7(9-3)8(2)5-6-8/h4H,1,5-6H2,2-3H3,(H,9,10) |
| InChIKey | XWYVGFUQFLOXMZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N',1-dimethylcyclopropane-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N',1-dimethylcyclopropane-1-carboximidamide?
The IUPAC name of N-ethenyl-N',1-dimethylcyclopropane-1-carboximidamide (CID 123875368) is N-ethenyl-N',1-dimethylcyclopropane-1-carboximidamide.
What is the SMILES notation for N-ethenyl-N',1-dimethylcyclopropane-1-carboximidamide?
The canonical SMILES for N-ethenyl-N',1-dimethylcyclopropane-1-carboximidamide is C=CN/C(=N\C)C1(C)CC1.
What is the InChIKey of N-ethenyl-N',1-dimethylcyclopropane-1-carboximidamide?
The InChIKey is XWYVGFUQFLOXMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-4-10-7(9-3)8(2)5-6-8/h4H,1,5-6H2,2-3H3,(H,9,10).
What are the key properties of N-ethenyl-N',1-dimethylcyclopropane-1-carboximidamide?
N-ethenyl-N',1-dimethylcyclopropane-1-carboximidamide has a molecular weight of 138.21 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N',1-dimethylcyclopropane-1-carboximidamide is sourced from PubChem (CID 123875368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).