C15H35NSi — CID 123875578
N,N-diethyl-2,2,4,4-tetramethyl-3-(2-silylethyl)pentan-3-amine (PubChem CID 123875578) has the molecular formula C15H35NSi and a molecular weight of 257.54 g/mol. Its IUPAC name is N,N-diethyl-2,2,4,4-tetramethyl-3-(2-silylethyl)pentan-3-amine.
| Compound Name | N,N-diethyl-2,2,4,4-tetramethyl-3-(2-silylethyl)pentan-3-amine |
|---|---|
| PubChem CID | 123875578 |
| Molecular Formula | C15H35NSi |
| Molecular Weight | 257.54 g/mol |
| Exact Mass | 257.25 |
| IUPAC Name | N,N-diethyl-2,2,4,4-tetramethyl-3-(2-silylethyl)pentan-3-amine |
| SMILES | CCN(CC)C(CC[SiH3])(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C15H35NSi/c1-9-16(10-2)15(11-12-17,13(3,4)5)14(6,7)8/h9-12H2,1-8,17H3 |
| InChIKey | ODCINZGESUOROL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.54 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|