C21H34N2O2S — CID 123875734
S-[4-[cyclohexyl(methyl)amino]-4-oxobutyl] 3,4,4a,5,6,7-hexahydro-1H-isoquinoline-2-carbothioate (PubChem CID 123875734) has the molecular formula C21H34N2O2S and a molecular weight of 378.58 g/mol. Its IUPAC name is S-[4-[cyclohexyl(methyl)amino]-4-oxobutyl] 3,4,4a,5,6,7-hexahydro-1H-isoquinoline-2-carbothioate.
| Compound Name | S-[4-[cyclohexyl(methyl)amino]-4-oxobutyl] 3,4,4a,5,6,7-hexahydro-1H-isoquinoline-2-carbothioate |
|---|---|
| PubChem CID | 123875734 |
| Molecular Formula | C21H34N2O2S |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | S-[4-[cyclohexyl(methyl)amino]-4-oxobutyl] 3,4,4a,5,6,7-hexahydro-1H-isoquinoline-2-carbothioate |
| SMILES | CN(C(=O)CCCSC(=O)N1CCC2CCCC=C2C1)C1CCCCC1 |
| InChI | InChI=1S/C21H34N2O2S/c1-22(19-10-3-2-4-11-19)20(24)12-7-15-26-21(25)23-14-13-17-8-5-6-9-18(17)16-23/h9,17,19H,2-8,10-16H2,1H3 |
| InChIKey | ZQWLKUVQJIDLMW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|