About [2-amino-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] butane-1-sulfonate
[2-amino-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] butane-1-sulfonate (PubChem CID 123875990) has the molecular formula C14H16ClNO5S
and a molecular weight of 345.80 g/mol. Its IUPAC name is [2-amino-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] butane-1-sulfonate.
Molecular Properties
| Compound Name | [2-amino-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] butane-1-sulfonate |
| PubChem CID | 123875990 |
| Molecular Formula | C14H16ClNO5S |
| Molecular Weight | 345.80 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | [2-amino-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] butane-1-sulfonate |
| SMILES | CCCCS(=O)(=O)Oc1c(N)oc(-c2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C14H16ClNO5S/c1-2-3-8-22(18,19)21-13-11(17)12(20-14(13)16)9-4-6-10(15)7-5-9/h4-7,17H,2-3,8,16H2,1H3 |
| InChIKey | XNULKQYZNDCWGF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.80 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-amino-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] butane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-amino-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] butane-1-sulfonate?
The IUPAC name of [2-amino-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] butane-1-sulfonate (CID 123875990) is [2-amino-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] butane-1-sulfonate.
What is the SMILES notation for [2-amino-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] butane-1-sulfonate?
The canonical SMILES for [2-amino-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] butane-1-sulfonate is CCCCS(=O)(=O)Oc1c(N)oc(-c2ccc(Cl)cc2)c1O.
What is the InChIKey of [2-amino-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] butane-1-sulfonate?
The InChIKey is XNULKQYZNDCWGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClNO5S/c1-2-3-8-22(18,19)21-13-11(17)12(20-14(13)16)9-4-6-10(15)7-5-9/h4-7,17H,2-3,8,16H2,1H3.
What are the key properties of [2-amino-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] butane-1-sulfonate?
[2-amino-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] butane-1-sulfonate has a molecular weight of 345.80 g/mol, XLogP of 3.40, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-amino-5-(4-chlorophenyl)-4-hydroxyfuran-3-yl] butane-1-sulfonate is sourced from PubChem (CID 123875990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).