C27H25N9O2S — CID 123876105
2-[1-[[2-amino-5-(2-aminoethanethioyl)pyrimidin-4-yl]amino]ethyl]-5-(2-methoxypyrimidin-5-yl)-3-phenylquinazolin-4-one (PubChem CID 123876105) has the molecular formula C27H25N9O2S and a molecular weight of 539.63 g/mol. Its IUPAC name is 2-[1-[[2-amino-5-(2-aminoethanethioyl)pyrimidin-4-yl]amino]ethyl]-5-(2-methoxypyrimidin-5-yl)-3-phenylquinazolin-4-one.
| Compound Name | 2-[1-[[2-amino-5-(2-aminoethanethioyl)pyrimidin-4-yl]amino]ethyl]-5-(2-methoxypyrimidin-5-yl)-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 123876105 |
| Molecular Formula | C27H25N9O2S |
| Molecular Weight | 539.63 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 2-[1-[[2-amino-5-(2-aminoethanethioyl)pyrimidin-4-yl]amino]ethyl]-5-(2-methoxypyrimidin-5-yl)-3-phenylquinazolin-4-one |
| SMILES | COc1ncc(-c2cccc3nc(C(C)Nc4nc(N)ncc4C(=S)CN)n(-c4ccccc4)c(=O)c23)cn1 |
| InChI | InChI=1S/C27H25N9O2S/c1-15(33-23-19(21(39)11-28)14-30-26(29)35-23)24-34-20-10-6-9-18(16-12-31-27(38-2)32-13-16)22(20)25(37)36(24)17-7-4-3-5-8-17/h3-10,12-15H,11,28H2,1-2H3,(H3,29,30,33,35) |
| InChIKey | MOAFAEFARQFWCZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 159.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.63 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|