About 6-ethyl-2,3-dihydro-1,5-naphthyridine
6-ethyl-2,3-dihydro-1,5-naphthyridine (PubChem CID 123877112) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 6-ethyl-2,3-dihydro-1,5-naphthyridine.
Molecular Properties
| Compound Name | 6-ethyl-2,3-dihydro-1,5-naphthyridine |
| PubChem CID | 123877112 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 6-ethyl-2,3-dihydro-1,5-naphthyridine |
| SMILES | CCc1ccc2c(n1)=CCCN=2 |
| InChI | InChI=1S/C10H12N2/c1-2-8-5-6-9-10(12-8)4-3-7-11-9/h4-6H,2-3,7H2,1H3 |
| InChIKey | JMOPCTWETFDETM-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethyl-2,3-dihydro-1,5-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2,3-dihydro-1,5-naphthyridine?
The IUPAC name of 6-ethyl-2,3-dihydro-1,5-naphthyridine (CID 123877112) is 6-ethyl-2,3-dihydro-1,5-naphthyridine.
What is the SMILES notation for 6-ethyl-2,3-dihydro-1,5-naphthyridine?
The canonical SMILES for 6-ethyl-2,3-dihydro-1,5-naphthyridine is CCc1ccc2c(n1)=CCCN=2.
What is the InChIKey of 6-ethyl-2,3-dihydro-1,5-naphthyridine?
The InChIKey is JMOPCTWETFDETM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-2-8-5-6-9-10(12-8)4-3-7-11-9/h4-6H,2-3,7H2,1H3.
What are the key properties of 6-ethyl-2,3-dihydro-1,5-naphthyridine?
6-ethyl-2,3-dihydro-1,5-naphthyridine has a molecular weight of 160.22 g/mol, XLogP of 0.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2,3-dihydro-1,5-naphthyridine is sourced from PubChem (CID 123877112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).