C35H33N5O6 — CID 123877258
[7-(2-methoxyethylcarbamoyl)pyrido[1,2-a]indole-10-carbonyl] 7-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylate (PubChem CID 123877258) has the molecular formula C35H33N5O6 and a molecular weight of 619.68 g/mol. Its IUPAC name is [7-(2-methoxyethylcarbamoyl)pyrido[1,2-a]indole-10-carbonyl] 7-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylate.
| Compound Name | [7-(2-methoxyethylcarbamoyl)pyrido[1,2-a]indole-10-carbonyl] 7-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylate |
|---|---|
| PubChem CID | 123877258 |
| Molecular Formula | C35H33N5O6 |
| Molecular Weight | 619.68 g/mol |
| Exact Mass | 619.24 |
| IUPAC Name | [7-(2-methoxyethylcarbamoyl)pyrido[1,2-a]indole-10-carbonyl] 7-[2-(dimethylamino)ethylcarbamoyl]pyrido[1,2-a]indole-10-carboxylate |
| SMILES | COCCNC(=O)c1ccc2c(C(=O)OC(=O)c3c4ccccc4n4cc(C(=O)NCCN(C)C)ccc34)c3ccccc3n2c1 |
| InChI | InChI=1S/C35H33N5O6/c1-38(2)18-16-36-32(41)22-12-14-28-30(24-8-4-6-10-26(24)39(28)20-22)34(43)46-35(44)31-25-9-5-7-11-27(25)40-21-23(13-15-29(31)40)33(42)37-17-19-45-3/h4-15,20-21H,16-19H2,1-3H3,(H,36,41)(H,37,42) |
| InChIKey | HSDBZYWMBDEOSU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 122.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.68 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|