About 4a,8a-dihydro-2H-1,4-benzoxazine-7-carboxamide
4a,8a-dihydro-2H-1,4-benzoxazine-7-carboxamide (PubChem CID 123877754) has the molecular formula C9H10N2O2
and a molecular weight of 178.19 g/mol. Its IUPAC name is 4a,8a-dihydro-2H-1,4-benzoxazine-7-carboxamide.
Molecular Properties
| Compound Name | 4a,8a-dihydro-2H-1,4-benzoxazine-7-carboxamide |
| PubChem CID | 123877754 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 4a,8a-dihydro-2H-1,4-benzoxazine-7-carboxamide |
| SMILES | NC(=O)C1=CC2OCC=NC2C=C1 |
| InChI | InChI=1S/C9H10N2O2/c10-9(12)6-1-2-7-8(5-6)13-4-3-11-7/h1-3,5,7-8H,4H2,(H2,10,12) |
| InChIKey | QOJHOMCQSDZZKR-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4a,8a-dihydro-2H-1,4-benzoxazine-7-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4a,8a-dihydro-2H-1,4-benzoxazine-7-carboxamide?
The IUPAC name of 4a,8a-dihydro-2H-1,4-benzoxazine-7-carboxamide (CID 123877754) is 4a,8a-dihydro-2H-1,4-benzoxazine-7-carboxamide.
What is the SMILES notation for 4a,8a-dihydro-2H-1,4-benzoxazine-7-carboxamide?
The canonical SMILES for 4a,8a-dihydro-2H-1,4-benzoxazine-7-carboxamide is NC(=O)C1=CC2OCC=NC2C=C1.
What is the InChIKey of 4a,8a-dihydro-2H-1,4-benzoxazine-7-carboxamide?
The InChIKey is QOJHOMCQSDZZKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c10-9(12)6-1-2-7-8(5-6)13-4-3-11-7/h1-3,5,7-8H,4H2,(H2,10,12).
What are the key properties of 4a,8a-dihydro-2H-1,4-benzoxazine-7-carboxamide?
4a,8a-dihydro-2H-1,4-benzoxazine-7-carboxamide has a molecular weight of 178.19 g/mol, XLogP of -0.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4a,8a-dihydro-2H-1,4-benzoxazine-7-carboxamide is sourced from PubChem (CID 123877754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).