About N-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1-methylindol-6-yl]-1,3-benzoxazol-5-amine
N-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1-methylindol-6-yl]-1,3-benzoxazol-5-amine (PubChem CID 123878892) has the molecular formula C23H27N4O+
and a molecular weight of 375.50 g/mol. Its IUPAC name is N-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1-methylindol-6-yl]-1,3-benzoxazol-5-amine.
Molecular Properties
| Compound Name | N-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1-methylindol-6-yl]-1,3-benzoxazol-5-amine |
| PubChem CID | 123878892 |
| Molecular Formula | C23H27N4O+ |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | N-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1-methylindol-6-yl]-1,3-benzoxazol-5-amine |
| SMILES | Cn1cc(C2CC[N+](C)(C)CC2)c2ccc(Nc3ccc4ocnc4c3)cc21 |
| InChI | InChI=1S/C23H27N4O/c1-26-14-20(16-8-10-27(2,3)11-9-16)19-6-4-18(13-22(19)26)25-17-5-7-23-21(12-17)24-15-28-23/h4-7,12-16,25H,8-11H2,1-3H3/q+1 |
| InChIKey | AKABUZSZESSIFC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1-methylindol-6-yl]-1,3-benzoxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1-methylindol-6-yl]-1,3-benzoxazol-5-amine?
The IUPAC name of N-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1-methylindol-6-yl]-1,3-benzoxazol-5-amine (CID 123878892) is N-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1-methylindol-6-yl]-1,3-benzoxazol-5-amine.
What is the SMILES notation for N-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1-methylindol-6-yl]-1,3-benzoxazol-5-amine?
The canonical SMILES for N-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1-methylindol-6-yl]-1,3-benzoxazol-5-amine is Cn1cc(C2CC[N+](C)(C)CC2)c2ccc(Nc3ccc4ocnc4c3)cc21.
What is the InChIKey of N-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1-methylindol-6-yl]-1,3-benzoxazol-5-amine?
The InChIKey is AKABUZSZESSIFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N4O/c1-26-14-20(16-8-10-27(2,3)11-9-16)19-6-4-18(13-22(19)26)25-17-5-7-23-21(12-17)24-15-28-23/h4-7,12-16,25H,8-11H2,1-3H3/q+1.
What are the key properties of N-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1-methylindol-6-yl]-1,3-benzoxazol-5-amine?
N-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1-methylindol-6-yl]-1,3-benzoxazol-5-amine has a molecular weight of 375.50 g/mol, XLogP of 5.02, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1,1-dimethylpiperidin-1-ium-4-yl)-1-methylindol-6-yl]-1,3-benzoxazol-5-amine is sourced from PubChem (CID 123878892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).