C14H23N3 — CID 123879104
2,6-dimethyl-8-(4-methylpiperazin-1-yl)-4,5-dihydroazocine (PubChem CID 123879104) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 2,6-dimethyl-8-(4-methylpiperazin-1-yl)-4,5-dihydroazocine.
| Compound Name | 2,6-dimethyl-8-(4-methylpiperazin-1-yl)-4,5-dihydroazocine |
|---|---|
| PubChem CID | 123879104 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 2,6-dimethyl-8-(4-methylpiperazin-1-yl)-4,5-dihydroazocine |
| SMILES | CC1=C/C(N2CCN(C)CC2)=N\C(C)=CCC1 |
| InChI | InChI=1S/C14H23N3/c1-12-5-4-6-13(2)15-14(11-12)17-9-7-16(3)8-10-17/h6,11H,4-5,7-10H2,1-3H3/b12-11?,13-6?,15-14+ |
| InChIKey | GAMMEVFNESNBLW-NKBXKWMCSA-N |
| XLogP | 2.28 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |