About S-[2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate
S-[2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate (PubChem CID 123879194) has the molecular formula C12H17ClFN3OS
and a molecular weight of 305.81 g/mol. Its IUPAC name is S-[2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate.
Molecular Properties
| Compound Name | S-[2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate |
| PubChem CID | 123879194 |
| Molecular Formula | C12H17ClFN3OS |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | S-[2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate |
| SMILES | CC(=O)SCC(Nc1nc(Cl)ncc1F)C(C)(C)C |
| InChI | InChI=1S/C12H17ClFN3OS/c1-7(18)19-6-9(12(2,3)4)16-10-8(14)5-15-11(13)17-10/h5,9H,6H2,1-4H3,(H,15,16,17) |
| InChIKey | RMPGWJSJCMHPKS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate?
The IUPAC name of S-[2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate (CID 123879194) is S-[2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate.
What is the SMILES notation for S-[2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate?
The canonical SMILES for S-[2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate is CC(=O)SCC(Nc1nc(Cl)ncc1F)C(C)(C)C.
What is the InChIKey of S-[2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate?
The InChIKey is RMPGWJSJCMHPKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClFN3OS/c1-7(18)19-6-9(12(2,3)4)16-10-8(14)5-15-11(13)17-10/h5,9H,6H2,1-4H3,(H,15,16,17).
What are the key properties of S-[2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate?
S-[2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate has a molecular weight of 305.81 g/mol, XLogP of 3.38, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-[(2-chloro-5-fluoropyrimidin-4-yl)amino]-3,3-dimethylbutyl] ethanethioate is sourced from PubChem (CID 123879194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).