C33H40N4O3 — CID 123879724
2-[[2-(2,4-dimethyl-3-pentylindol-1-yl)acetyl]amino]-N-(6-methoxy-3-pyridinyl)-N-methyl-3-phenylpropanamide (PubChem CID 123879724) has the molecular formula C33H40N4O3 and a molecular weight of 540.71 g/mol. Its IUPAC name is 2-[[2-(2,4-dimethyl-3-pentylindol-1-yl)acetyl]amino]-N-(6-methoxy-3-pyridinyl)-N-methyl-3-phenylpropanamide.
| Compound Name | 2-[[2-(2,4-dimethyl-3-pentylindol-1-yl)acetyl]amino]-N-(6-methoxy-3-pyridinyl)-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 123879724 |
| Molecular Formula | C33H40N4O3 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | 2-[[2-(2,4-dimethyl-3-pentylindol-1-yl)acetyl]amino]-N-(6-methoxy-3-pyridinyl)-N-methyl-3-phenylpropanamide |
| SMILES | CCCCCc1c(C)n(CC(=O)NC(Cc2ccccc2)C(=O)N(C)c2ccc(OC)nc2)c2cccc(C)c12 |
| InChI | InChI=1S/C33H40N4O3/c1-6-7-9-16-27-24(3)37(29-17-12-13-23(2)32(27)29)22-30(38)35-28(20-25-14-10-8-11-15-25)33(39)36(4)26-18-19-31(40-5)34-21-26/h8,10-15,17-19,21,28H,6-7,9,16,20,22H2,1-5H3,(H,35,38) |
| InChIKey | YDADDSLUKCTFEF-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|