About [2-pyridin-2-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate
[2-pyridin-2-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 123879784) has the molecular formula C19H20N4O5S
and a molecular weight of 416.46 g/mol. Its IUPAC name is [2-pyridin-2-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [2-pyridin-2-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
| PubChem CID | 123879784 |
| Molecular Formula | C19H20N4O5S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [2-pyridin-2-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2COC(Cn3nccn3)(c3ccccn3)O2)cc1 |
| InChI | InChI=1S/C19H20N4O5S/c1-15-5-7-17(8-6-15)29(24,25)27-13-16-12-26-19(28-16,14-23-21-10-11-22-23)18-4-2-3-9-20-18/h2-11,16H,12-14H2,1H3 |
| InChIKey | CFIPXZLVGBGQEY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-pyridin-2-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-pyridin-2-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate?
The IUPAC name of [2-pyridin-2-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate (CID 123879784) is [2-pyridin-2-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate.
What is the SMILES notation for [2-pyridin-2-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate?
The canonical SMILES for [2-pyridin-2-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC2COC(Cn3nccn3)(c3ccccn3)O2)cc1.
What is the InChIKey of [2-pyridin-2-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate?
The InChIKey is CFIPXZLVGBGQEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O5S/c1-15-5-7-17(8-6-15)29(24,25)27-13-16-12-26-19(28-16,14-23-21-10-11-22-23)18-4-2-3-9-20-18/h2-11,16H,12-14H2,1H3.
What are the key properties of [2-pyridin-2-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate?
[2-pyridin-2-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate has a molecular weight of 416.46 g/mol, XLogP of 1.66, 7 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2-pyridin-2-yl-2-(triazol-2-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 123879784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).