About 4-penta-1,3-dien-2-yl-1H-pyrazole
4-penta-1,3-dien-2-yl-1H-pyrazole (PubChem CID 123880158) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 4-penta-1,3-dien-2-yl-1H-pyrazole.
Molecular Properties
| Compound Name | 4-penta-1,3-dien-2-yl-1H-pyrazole |
| PubChem CID | 123880158 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 4-penta-1,3-dien-2-yl-1H-pyrazole |
| SMILES | C=C(C=CC)c1cn[nH]c1 |
| InChI | InChI=1S/C8H10N2/c1-3-4-7(2)8-5-9-10-6-8/h3-6H,2H2,1H3,(H,9,10) |
| InChIKey | SFUQPURFZHUHTK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-penta-1,3-dien-2-yl-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-penta-1,3-dien-2-yl-1H-pyrazole?
The IUPAC name of 4-penta-1,3-dien-2-yl-1H-pyrazole (CID 123880158) is 4-penta-1,3-dien-2-yl-1H-pyrazole.
What is the SMILES notation for 4-penta-1,3-dien-2-yl-1H-pyrazole?
The canonical SMILES for 4-penta-1,3-dien-2-yl-1H-pyrazole is C=C(C=CC)c1cn[nH]c1.
What is the InChIKey of 4-penta-1,3-dien-2-yl-1H-pyrazole?
The InChIKey is SFUQPURFZHUHTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-3-4-7(2)8-5-9-10-6-8/h3-6H,2H2,1H3,(H,9,10).
What are the key properties of 4-penta-1,3-dien-2-yl-1H-pyrazole?
4-penta-1,3-dien-2-yl-1H-pyrazole has a molecular weight of 134.18 g/mol, XLogP of 2.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-penta-1,3-dien-2-yl-1H-pyrazole is sourced from PubChem (CID 123880158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).