About [1-(2,5-dimethylfuran-3-yl)-2,2-dimethylpropoxy]-dimethylsilane
[1-(2,5-dimethylfuran-3-yl)-2,2-dimethylpropoxy]-dimethylsilane (PubChem CID 123880326) has the molecular formula C13H24O2Si
and a molecular weight of 240.42 g/mol. Its IUPAC name is [1-(2,5-dimethylfuran-3-yl)-2,2-dimethylpropoxy]-dimethylsilane.
Molecular Properties
| Compound Name | [1-(2,5-dimethylfuran-3-yl)-2,2-dimethylpropoxy]-dimethylsilane |
| PubChem CID | 123880326 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | [1-(2,5-dimethylfuran-3-yl)-2,2-dimethylpropoxy]-dimethylsilane |
| SMILES | Cc1cc(C(O[SiH](C)C)C(C)(C)C)c(C)o1 |
| InChI | InChI=1S/C13H24O2Si/c1-9-8-11(10(2)14-9)12(13(3,4)5)15-16(6)7/h8,12,16H,1-7H3 |
| InChIKey | XHXNWCAKSFPQRH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,5-dimethylfuran-3-yl)-2,2-dimethylpropoxy]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,5-dimethylfuran-3-yl)-2,2-dimethylpropoxy]-dimethylsilane?
The IUPAC name of [1-(2,5-dimethylfuran-3-yl)-2,2-dimethylpropoxy]-dimethylsilane (CID 123880326) is [1-(2,5-dimethylfuran-3-yl)-2,2-dimethylpropoxy]-dimethylsilane.
What is the SMILES notation for [1-(2,5-dimethylfuran-3-yl)-2,2-dimethylpropoxy]-dimethylsilane?
The canonical SMILES for [1-(2,5-dimethylfuran-3-yl)-2,2-dimethylpropoxy]-dimethylsilane is Cc1cc(C(O[SiH](C)C)C(C)(C)C)c(C)o1.
What is the InChIKey of [1-(2,5-dimethylfuran-3-yl)-2,2-dimethylpropoxy]-dimethylsilane?
The InChIKey is XHXNWCAKSFPQRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2Si/c1-9-8-11(10(2)14-9)12(13(3,4)5)15-16(6)7/h8,12,16H,1-7H3.
What are the key properties of [1-(2,5-dimethylfuran-3-yl)-2,2-dimethylpropoxy]-dimethylsilane?
[1-(2,5-dimethylfuran-3-yl)-2,2-dimethylpropoxy]-dimethylsilane has a molecular weight of 240.42 g/mol, XLogP of 3.98, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,5-dimethylfuran-3-yl)-2,2-dimethylpropoxy]-dimethylsilane is sourced from PubChem (CID 123880326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).