About 2-(thiophen-2-ylmethylidene)-4H-pyrido[3,2-b][1,4]oxazin-3-one
2-(thiophen-2-ylmethylidene)-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 123881056) has the molecular formula C12H8N2O2S
and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-(thiophen-2-ylmethylidene)-4H-pyrido[3,2-b][1,4]oxazin-3-one.
Molecular Properties
| Compound Name | 2-(thiophen-2-ylmethylidene)-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| PubChem CID | 123881056 |
| Molecular Formula | C12H8N2O2S |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 2-(thiophen-2-ylmethylidene)-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | O=C1Nc2ncccc2OC1=Cc1cccs1 |
| InChI | InChI=1S/C12H8N2O2S/c15-12-10(7-8-3-2-6-17-8)16-9-4-1-5-13-11(9)14-12/h1-7H,(H,13,14,15) |
| InChIKey | XMPKDMRPJOWKBP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(thiophen-2-ylmethylidene)-4H-pyrido[3,2-b][1,4]oxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(thiophen-2-ylmethylidene)-4H-pyrido[3,2-b][1,4]oxazin-3-one?
The IUPAC name of 2-(thiophen-2-ylmethylidene)-4H-pyrido[3,2-b][1,4]oxazin-3-one (CID 123881056) is 2-(thiophen-2-ylmethylidene)-4H-pyrido[3,2-b][1,4]oxazin-3-one.
What is the SMILES notation for 2-(thiophen-2-ylmethylidene)-4H-pyrido[3,2-b][1,4]oxazin-3-one?
The canonical SMILES for 2-(thiophen-2-ylmethylidene)-4H-pyrido[3,2-b][1,4]oxazin-3-one is O=C1Nc2ncccc2OC1=Cc1cccs1.
What is the InChIKey of 2-(thiophen-2-ylmethylidene)-4H-pyrido[3,2-b][1,4]oxazin-3-one?
The InChIKey is XMPKDMRPJOWKBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2S/c15-12-10(7-8-3-2-6-17-8)16-9-4-1-5-13-11(9)14-12/h1-7H,(H,13,14,15).
What are the key properties of 2-(thiophen-2-ylmethylidene)-4H-pyrido[3,2-b][1,4]oxazin-3-one?
2-(thiophen-2-ylmethylidene)-4H-pyrido[3,2-b][1,4]oxazin-3-one has a molecular weight of 244.28 g/mol, XLogP of 2.52, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(thiophen-2-ylmethylidene)-4H-pyrido[3,2-b][1,4]oxazin-3-one is sourced from PubChem (CID 123881056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).