C14H27NO — CID 123881248
2,2,4-trimethyl-1-(2-methylpiperidin-1-yl)pentan-1-one (PubChem CID 123881248) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 2,2,4-trimethyl-1-(2-methylpiperidin-1-yl)pentan-1-one.
| Compound Name | 2,2,4-trimethyl-1-(2-methylpiperidin-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 123881248 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 2,2,4-trimethyl-1-(2-methylpiperidin-1-yl)pentan-1-one |
| SMILES | CC(C)CC(C)(C)C(=O)N1CCCCC1C |
| InChI | InChI=1S/C14H27NO/c1-11(2)10-14(4,5)13(16)15-9-7-6-8-12(15)3/h11-12H,6-10H2,1-5H3 |
| InChIKey | VGKIJAGFTCPQSS-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |