C53H40Cl2F6N2O5 — CID 123882305
bis[2-[7-chloro-3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]quinolin-4-yl]ethyl] carbonate (PubChem CID 123882305) has the molecular formula C53H40Cl2F6N2O5 and a molecular weight of 969.81 g/mol. Its IUPAC name is bis[2-[7-chloro-3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]quinolin-4-yl]ethyl] carbonate.
| Compound Name | bis[2-[7-chloro-3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]quinolin-4-yl]ethyl] carbonate |
|---|---|
| PubChem CID | 123882305 |
| Molecular Formula | C53H40Cl2F6N2O5 |
| Molecular Weight | 969.81 g/mol |
| Exact Mass | 968.22 |
| IUPAC Name | bis[2-[7-chloro-3-methyl-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]quinolin-4-yl]ethyl] carbonate |
| SMILES | Cc1c(-c2ccc(Cc3ccc(OC(F)(F)F)cc3)cc2)nc2cc(Cl)ccc2c1CCOC(=O)OCCc1c(C)c(-c2ccc(Cc3ccc(OC(F)(F)F)cc3)cc2)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C53H40Cl2F6N2O5/c1-31-43(45-21-15-39(54)29-47(45)62-49(31)37-11-3-33(4-12-37)27-35-7-17-41(18-8-35)67-52(56,57)58)23-25-65-51(64)66-26-24-44-32(2)50(63-48-30-40(55)16-22-46(44)48)38-13-5-34(6-14-38)28-36-9-19-42(20-10-36)68-53(59,60)61/h3-22,29-30H,23-28H2,1-2H3 |
| InChIKey | WLPNMSNPIHNEGB-UHFFFAOYSA-N |
| XLogP | 14.96 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 969.81 |
| LogP ≤ 5 | 14.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |