C31H40F2N6O4Si — CID 123882775
4-[3-amino-2-(2,4-difluorophenoxy)-4-(2-morpholin-4-ylethylamino)phenyl]-6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-c]pyridin-7-one (PubChem CID 123882775) has the molecular formula C31H40F2N6O4Si and a molecular weight of 626.78 g/mol. Its IUPAC name is 4-[3-amino-2-(2,4-difluorophenoxy)-4-(2-morpholin-4-ylethylamino)phenyl]-6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-c]pyridin-7-one.
| Compound Name | 4-[3-amino-2-(2,4-difluorophenoxy)-4-(2-morpholin-4-ylethylamino)phenyl]-6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-c]pyridin-7-one |
|---|---|
| PubChem CID | 123882775 |
| Molecular Formula | C31H40F2N6O4Si |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.28 |
| IUPAC Name | 4-[3-amino-2-(2,4-difluorophenoxy)-4-(2-morpholin-4-ylethylamino)phenyl]-6-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[5,4-c]pyridin-7-one |
| SMILES | Cn1cc(-c2ccc(NCCN3CCOCC3)c(N)c2Oc2ccc(F)cc2F)c2cnn(COCC[Si](C)(C)C)c2c1=O |
| InChI | InChI=1S/C31H40F2N6O4Si/c1-37-19-24(23-18-36-39(29(23)31(37)40)20-42-15-16-44(2,3)4)22-6-7-26(35-9-10-38-11-13-41-14-12-38)28(34)30(22)43-27-8-5-21(32)17-25(27)33/h5-8,17-19,35H,9-16,20,34H2,1-4H3 |
| InChIKey | ZWHLGBYZQISRKF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 108.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|