About 4-(ethylamino)-2,3-dimethylbut-2-enamide
4-(ethylamino)-2,3-dimethylbut-2-enamide (PubChem CID 123883095) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 4-(ethylamino)-2,3-dimethylbut-2-enamide.
Molecular Properties
| Compound Name | 4-(ethylamino)-2,3-dimethylbut-2-enamide |
| PubChem CID | 123883095 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 4-(ethylamino)-2,3-dimethylbut-2-enamide |
| SMILES | CCNCC(C)=C(C)C(N)=O |
| InChI | InChI=1S/C8H16N2O/c1-4-10-5-6(2)7(3)8(9)11/h10H,4-5H2,1-3H3,(H2,9,11) |
| InChIKey | WIJHQHPCCKDILE-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(ethylamino)-2,3-dimethylbut-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethylamino)-2,3-dimethylbut-2-enamide?
The IUPAC name of 4-(ethylamino)-2,3-dimethylbut-2-enamide (CID 123883095) is 4-(ethylamino)-2,3-dimethylbut-2-enamide.
What is the SMILES notation for 4-(ethylamino)-2,3-dimethylbut-2-enamide?
The canonical SMILES for 4-(ethylamino)-2,3-dimethylbut-2-enamide is CCNCC(C)=C(C)C(N)=O.
What is the InChIKey of 4-(ethylamino)-2,3-dimethylbut-2-enamide?
The InChIKey is WIJHQHPCCKDILE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-4-10-5-6(2)7(3)8(9)11/h10H,4-5H2,1-3H3,(H2,9,11).
What are the key properties of 4-(ethylamino)-2,3-dimethylbut-2-enamide?
4-(ethylamino)-2,3-dimethylbut-2-enamide has a molecular weight of 156.23 g/mol, XLogP of 0.42, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethylamino)-2,3-dimethylbut-2-enamide is sourced from PubChem (CID 123883095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).