C27H49ClFN7O — CID 123883237
2-amino-N-[5-chloro-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)piperidin-3-yl]-6-ethyl-4-[2-fluorohexyl(methyl)amino]-2,3,4,5-tetrahydropyridine-3-carboxamide (PubChem CID 123883237) has the molecular formula C27H49ClFN7O and a molecular weight of 542.19 g/mol. Its IUPAC name is 2-amino-N-[5-chloro-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)piperidin-3-yl]-6-ethyl-4-[2-fluorohexyl(methyl)amino]-2,3,4,5-tetrahydropyridine-3-carboxamide.
| Compound Name | 2-amino-N-[5-chloro-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)piperidin-3-yl]-6-ethyl-4-[2-fluorohexyl(methyl)amino]-2,3,4,5-tetrahydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 123883237 |
| Molecular Formula | C27H49ClFN7O |
| Molecular Weight | 542.19 g/mol |
| Exact Mass | 541.37 |
| IUPAC Name | 2-amino-N-[5-chloro-4-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)piperidin-3-yl]-6-ethyl-4-[2-fluorohexyl(methyl)amino]-2,3,4,5-tetrahydropyridine-3-carboxamide |
| SMILES | CCCCC(F)CN(C)C1CC(CC)=NC(N)C1C(=O)NC1CNCC(Cl)C1N1CC2CN(C)CC2C1 |
| InChI | InChI=1S/C27H49ClFN7O/c1-5-7-8-19(29)16-35(4)23-9-20(6-2)32-26(30)24(23)27(37)33-22-11-31-10-21(28)25(22)36-14-17-12-34(3)13-18(17)15-36/h17-19,21-26,31H,5-16,30H2,1-4H3,(H,33,37) |
| InChIKey | ONXHGLWGJZFVQM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.19 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|