C24H31N5O2S — CID 123883657
N-[[1-(4-hept-3-ynylcyclohexyl)imidazo[4,5-c][1,5]naphthyridin-2-yl]methyl]methanesulfonamide (PubChem CID 123883657) has the molecular formula C24H31N5O2S and a molecular weight of 453.61 g/mol. Its IUPAC name is N-[[1-(4-hept-3-ynylcyclohexyl)imidazo[4,5-c][1,5]naphthyridin-2-yl]methyl]methanesulfonamide.
| Compound Name | N-[[1-(4-hept-3-ynylcyclohexyl)imidazo[4,5-c][1,5]naphthyridin-2-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 123883657 |
| Molecular Formula | C24H31N5O2S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | N-[[1-(4-hept-3-ynylcyclohexyl)imidazo[4,5-c][1,5]naphthyridin-2-yl]methyl]methanesulfonamide |
| SMILES | CCCC#CCCC1CCC(n2c(CNS(C)(=O)=O)nc3cnc4cccnc4c32)CC1 |
| InChI | InChI=1S/C24H31N5O2S/c1-3-4-5-6-7-9-18-11-13-19(14-12-18)29-22(17-27-32(2,30)31)28-21-16-26-20-10-8-15-25-23(20)24(21)29/h8,10,15-16,18-19,27H,3-4,7,9,11-14,17H2,1-2H3 |
| InChIKey | DQWKEZFPOKKNRA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|