C39H50OS — CID 123885244
1,7,8,8a-tetrahydronaphthalen-2-yl-[4-(2-cyclohexylethoxy)-1,2,7,8-tetrahydronaphthalen-1-yl]-methyl-(1,2,7,8-tetrahydronaphthalen-2-yl)-λ4-sulfane (PubChem CID 123885244) has the molecular formula C39H50OS and a molecular weight of 566.90 g/mol. Its IUPAC name is 1,7,8,8a-tetrahydronaphthalen-2-yl-[4-(2-cyclohexylethoxy)-1,2,7,8-tetrahydronaphthalen-1-yl]-methyl-(1,2,7,8-tetrahydronaphthalen-2-yl)-λ4-sulfane.
| Compound Name | 1,7,8,8a-tetrahydronaphthalen-2-yl-[4-(2-cyclohexylethoxy)-1,2,7,8-tetrahydronaphthalen-1-yl]-methyl-(1,2,7,8-tetrahydronaphthalen-2-yl)-λ4-sulfane |
|---|---|
| PubChem CID | 123885244 |
| Molecular Formula | C39H50OS |
| Molecular Weight | 566.90 g/mol |
| Exact Mass | 566.36 |
| IUPAC Name | 1,7,8,8a-tetrahydronaphthalen-2-yl-[4-(2-cyclohexylethoxy)-1,2,7,8-tetrahydronaphthalen-1-yl]-methyl-(1,2,7,8-tetrahydronaphthalen-2-yl)-λ4-sulfane |
| SMILES | CS(C1=CC=C2C=CCCC2C1)(C1C=CC2=C(CCC=C2)C1)C1CC=C(OCCC2CCCCC2)C2=C1CCC=C2 |
| InChI | InChI=1S/C39H50OS/c1-41(34-21-19-30-13-5-7-15-32(30)27-34,35-22-20-31-14-6-8-16-33(31)28-35)39-24-23-38(36-17-9-10-18-37(36)39)40-26-25-29-11-3-2-4-12-29/h5-6,9,13-14,17,19-23,29,32,35,39H,2-4,7-8,10-12,15-16,18,24-28H2,1H3 |
| InChIKey | XLFAMULFEZYSIM-UHFFFAOYSA-N |
| XLogP | 10.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.90 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |