C14H21ClFN — CID 123885784
(Z)-N-[(1E)-3-chloro-4-fluoro-5-methylhexa-1,3-dienyl]hept-4-en-3-imine (PubChem CID 123885784) has the molecular formula C14H21ClFN and a molecular weight of 257.78 g/mol. Its IUPAC name is (Z)-N-[(1E)-3-chloro-4-fluoro-5-methylhexa-1,3-dienyl]hept-4-en-3-imine.
| Compound Name | (Z)-N-[(1E)-3-chloro-4-fluoro-5-methylhexa-1,3-dienyl]hept-4-en-3-imine |
|---|---|
| PubChem CID | 123885784 |
| Molecular Formula | C14H21ClFN |
| Molecular Weight | 257.78 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | (Z)-N-[(1E)-3-chloro-4-fluoro-5-methylhexa-1,3-dienyl]hept-4-en-3-imine |
| SMILES | CC/C=C\C(CC)=N\C=C\C(Cl)=C(F)C(C)C |
| InChI | InChI=1S/C14H21ClFN/c1-5-7-8-12(6-2)17-10-9-13(15)14(16)11(3)4/h7-11H,5-6H2,1-4H3/b8-7-,10-9+,14-13?,17-12+ |
| InChIKey | UCOATEJPSHGRNC-CLJIBAHQSA-N |
| XLogP | 5.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.78 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|