C32H33F5O — CID 123885886
9-[(3,4-difluorophenyl)methyl]-3-methyl-13-[[4-(trifluoromethyl)phenyl]methyl]-6,7,8,9,10,11,12,13-octahydro-5H-benzo[12]annulen-14-one (PubChem CID 123885886) has the molecular formula C32H33F5O and a molecular weight of 528.61 g/mol. Its IUPAC name is 9-[(3,4-difluorophenyl)methyl]-3-methyl-13-[[4-(trifluoromethyl)phenyl]methyl]-6,7,8,9,10,11,12,13-octahydro-5H-benzo[12]annulen-14-one.
| Compound Name | 9-[(3,4-difluorophenyl)methyl]-3-methyl-13-[[4-(trifluoromethyl)phenyl]methyl]-6,7,8,9,10,11,12,13-octahydro-5H-benzo[12]annulen-14-one |
|---|---|
| PubChem CID | 123885886 |
| Molecular Formula | C32H33F5O |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.25 |
| IUPAC Name | 9-[(3,4-difluorophenyl)methyl]-3-methyl-13-[[4-(trifluoromethyl)phenyl]methyl]-6,7,8,9,10,11,12,13-octahydro-5H-benzo[12]annulen-14-one |
| SMILES | Cc1ccc2c(c1)CCCCC(Cc1ccc(F)c(F)c1)CCCC(Cc1ccc(C(F)(F)F)cc1)C2=O |
| InChI | InChI=1S/C32H33F5O/c1-21-9-15-28-25(17-21)7-3-2-5-22(18-24-12-16-29(33)30(34)20-24)6-4-8-26(31(28)38)19-23-10-13-27(14-11-23)32(35,36)37/h9-17,20,22,26H,2-8,18-19H2,1H3 |
| InChIKey | FDOMBFUWRKHAIZ-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |