C17H17ClN2O4S — CID 123886258
8-chloro-7-(2,2-dimethoxyethoxy)-2-(2-methyl-1,3-thiazol-4-yl)-1H-quinolin-4-one (PubChem CID 123886258) has the molecular formula C17H17ClN2O4S and a molecular weight of 380.85 g/mol. Its IUPAC name is 8-chloro-7-(2,2-dimethoxyethoxy)-2-(2-methyl-1,3-thiazol-4-yl)-1H-quinolin-4-one.
| Compound Name | 8-chloro-7-(2,2-dimethoxyethoxy)-2-(2-methyl-1,3-thiazol-4-yl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 123886258 |
| Molecular Formula | C17H17ClN2O4S |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 8-chloro-7-(2,2-dimethoxyethoxy)-2-(2-methyl-1,3-thiazol-4-yl)-1H-quinolin-4-one |
| SMILES | COC(COc1ccc2c(=O)cc(-c3csc(C)n3)[nH]c2c1Cl)OC |
| InChI | InChI=1S/C17H17ClN2O4S/c1-9-19-12(8-25-9)11-6-13(21)10-4-5-14(16(18)17(10)20-11)24-7-15(22-2)23-3/h4-6,8,15H,7H2,1-3H3,(H,20,21) |
| InChIKey | RNSKLXFPJBBQKF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|