About 2-(4,5-dimethoxy-2-nitrophenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]acetamide
2-(4,5-dimethoxy-2-nitrophenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]acetamide (PubChem CID 1238869) has the molecular formula C25H26N2O6
and a molecular weight of 450.49 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-nitrophenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]acetamide.
Molecular Properties
| Compound Name | 2-(4,5-dimethoxy-2-nitrophenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]acetamide |
| PubChem CID | 1238869 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-(4,5-dimethoxy-2-nitrophenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]acetamide |
| SMILES | COc1cc(CC(=O)NCCc2ccc(OCc3ccccc3)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C25H26N2O6/c1-31-23-14-20(22(27(29)30)16-24(23)32-2)15-25(28)26-13-12-18-8-10-21(11-9-18)33-17-19-6-4-3-5-7-19/h3-11,14,16H,12-13,15,17H2,1-2H3,(H,26,28) |
| InChIKey | YHCKQRUIDAPTEG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dimethoxy-2-nitrophenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethoxy-2-nitrophenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]acetamide?
The IUPAC name of 2-(4,5-dimethoxy-2-nitrophenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]acetamide (CID 1238869) is 2-(4,5-dimethoxy-2-nitrophenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]acetamide.
What is the SMILES notation for 2-(4,5-dimethoxy-2-nitrophenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]acetamide?
The canonical SMILES for 2-(4,5-dimethoxy-2-nitrophenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]acetamide is COc1cc(CC(=O)NCCc2ccc(OCc3ccccc3)cc2)c([N+](=O)[O-])cc1OC.
What is the InChIKey of 2-(4,5-dimethoxy-2-nitrophenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]acetamide?
The InChIKey is YHCKQRUIDAPTEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26N2O6/c1-31-23-14-20(22(27(29)30)16-24(23)32-2)15-25(28)26-13-12-18-8-10-21(11-9-18)33-17-19-6-4-3-5-7-19/h3-11,14,16H,12-13,15,17H2,1-2H3,(H,26,28).
What are the key properties of 2-(4,5-dimethoxy-2-nitrophenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]acetamide?
2-(4,5-dimethoxy-2-nitrophenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]acetamide has a molecular weight of 450.49 g/mol, XLogP of 4.09, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethoxy-2-nitrophenyl)-N-[2-(4-phenylmethoxyphenyl)ethyl]acetamide is sourced from PubChem (CID 1238869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).