About 1H-cycloocta[d]imidazole
1H-cycloocta[d]imidazole (PubChem CID 123886935) has the molecular formula C9H8N2
and a molecular weight of 144.18 g/mol. Its IUPAC name is 1H-cycloocta[d]imidazole.
Molecular Properties
| Compound Name | 1H-cycloocta[d]imidazole |
| PubChem CID | 123886935 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | 1H-cycloocta[d]imidazole |
| SMILES | C1=CC=c2nc[nH]c2=CC=C1 |
| InChI | InChI=1S/C9H8N2/c1-2-4-6-9-8(5-3-1)10-7-11-9/h1-7H,(H,10,11) |
| InChIKey | ZCEBQBLAXVRAFG-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1H-cycloocta[d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-cycloocta[d]imidazole?
The IUPAC name of 1H-cycloocta[d]imidazole (CID 123886935) is 1H-cycloocta[d]imidazole.
What is the SMILES notation for 1H-cycloocta[d]imidazole?
The canonical SMILES for 1H-cycloocta[d]imidazole is C1=CC=c2nc[nH]c2=CC=C1.
What is the InChIKey of 1H-cycloocta[d]imidazole?
The InChIKey is ZCEBQBLAXVRAFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2/c1-2-4-6-9-8(5-3-1)10-7-11-9/h1-7H,(H,10,11).
What are the key properties of 1H-cycloocta[d]imidazole?
1H-cycloocta[d]imidazole has a molecular weight of 144.18 g/mol, XLogP of 0.10, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-cycloocta[d]imidazole is sourced from PubChem (CID 123886935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).