C20H26FN5O2 — CID 123886971
N-(N'-ethylcarbamimidoyl)-2-[2-fluoro-5-[(6-methoxy-3-pyridinyl)amino]phenyl]-N,2-dimethylpropanamide (PubChem CID 123886971) has the molecular formula C20H26FN5O2 and a molecular weight of 387.46 g/mol. Its IUPAC name is N-(N'-ethylcarbamimidoyl)-2-[2-fluoro-5-[(6-methoxy-3-pyridinyl)amino]phenyl]-N,2-dimethylpropanamide.
| Compound Name | N-(N'-ethylcarbamimidoyl)-2-[2-fluoro-5-[(6-methoxy-3-pyridinyl)amino]phenyl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 123886971 |
| Molecular Formula | C20H26FN5O2 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | N-(N'-ethylcarbamimidoyl)-2-[2-fluoro-5-[(6-methoxy-3-pyridinyl)amino]phenyl]-N,2-dimethylpropanamide |
| SMILES | CC/N=C(\N)N(C)C(=O)C(C)(C)c1cc(Nc2ccc(OC)nc2)ccc1F |
| InChI | InChI=1S/C20H26FN5O2/c1-6-23-19(22)26(4)18(27)20(2,3)15-11-13(7-9-16(15)21)25-14-8-10-17(28-5)24-12-14/h7-12,25H,6H2,1-5H3,(H2,22,23) |
| InChIKey | HXGKQZOBHUXEMC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|