About 7-fluoro-4-[4-(trifluoromethyl)imidazol-1-yl]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one
7-fluoro-4-[4-(trifluoromethyl)imidazol-1-yl]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one (PubChem CID 123886990) has the molecular formula C11H6F4N4O
and a molecular weight of 286.19 g/mol. Its IUPAC name is 7-fluoro-4-[4-(trifluoromethyl)imidazol-1-yl]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one.
Molecular Properties
| Compound Name | 7-fluoro-4-[4-(trifluoromethyl)imidazol-1-yl]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
| PubChem CID | 123886990 |
| Molecular Formula | C11H6F4N4O |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 7-fluoro-4-[4-(trifluoromethyl)imidazol-1-yl]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one |
| SMILES | O=C1NCc2c(F)cnc(-n3cnc(C(F)(F)F)c3)c21 |
| InChI | InChI=1S/C11H6F4N4O/c12-6-2-16-9(8-5(6)1-17-10(8)20)19-3-7(18-4-19)11(13,14)15/h2-4H,1H2,(H,17,20) |
| InChIKey | UGLMEIPRQGMGMR-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-fluoro-4-[4-(trifluoromethyl)imidazol-1-yl]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-4-[4-(trifluoromethyl)imidazol-1-yl]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one?
The IUPAC name of 7-fluoro-4-[4-(trifluoromethyl)imidazol-1-yl]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one (CID 123886990) is 7-fluoro-4-[4-(trifluoromethyl)imidazol-1-yl]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one.
What is the SMILES notation for 7-fluoro-4-[4-(trifluoromethyl)imidazol-1-yl]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one?
The canonical SMILES for 7-fluoro-4-[4-(trifluoromethyl)imidazol-1-yl]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one is O=C1NCc2c(F)cnc(-n3cnc(C(F)(F)F)c3)c21.
What is the InChIKey of 7-fluoro-4-[4-(trifluoromethyl)imidazol-1-yl]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one?
The InChIKey is UGLMEIPRQGMGMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F4N4O/c12-6-2-16-9(8-5(6)1-17-10(8)20)19-3-7(18-4-19)11(13,14)15/h2-4H,1H2,(H,17,20).
What are the key properties of 7-fluoro-4-[4-(trifluoromethyl)imidazol-1-yl]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one?
7-fluoro-4-[4-(trifluoromethyl)imidazol-1-yl]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one has a molecular weight of 286.19 g/mol, XLogP of 1.67, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-4-[4-(trifluoromethyl)imidazol-1-yl]-1,2-dihydropyrrolo[3,4-c]pyridin-3-one is sourced from PubChem (CID 123886990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).