C9H11BrN3O2+ — CID 123887303
[2-bromo-5-(hydroxymethyl)-4-methylpyrrolo[2,3-b]pyrazin-4-ium-7-yl]methanol (PubChem CID 123887303) has the molecular formula C9H11BrN3O2+ and a molecular weight of 273.11 g/mol. Its IUPAC name is [2-bromo-5-(hydroxymethyl)-4-methylpyrrolo[2,3-b]pyrazin-4-ium-7-yl]methanol.
| Compound Name | [2-bromo-5-(hydroxymethyl)-4-methylpyrrolo[2,3-b]pyrazin-4-ium-7-yl]methanol |
|---|---|
| PubChem CID | 123887303 |
| Molecular Formula | C9H11BrN3O2+ |
| Molecular Weight | 273.11 g/mol |
| Exact Mass | 272.00 |
| IUPAC Name | [2-bromo-5-(hydroxymethyl)-4-methylpyrrolo[2,3-b]pyrazin-4-ium-7-yl]methanol |
| SMILES | C[n+]1cc(Br)nc2c(CO)cn(CO)c21 |
| InChI | InChI=1S/C9H11BrN3O2/c1-12-3-7(10)11-8-6(4-14)2-13(5-15)9(8)12/h2-3,14-15H,4-5H2,1H3/q+1 |
| InChIKey | UWOVSSFCOXVEPC-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.11 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|