About 1-[4-(trimethyl-λ4-sulfanyl)piperazin-1-yl]ethanone
1-[4-(trimethyl-λ4-sulfanyl)piperazin-1-yl]ethanone (PubChem CID 123887418) has the molecular formula C9H20N2OS
and a molecular weight of 204.34 g/mol. Its IUPAC name is 1-[4-(trimethyl-λ4-sulfanyl)piperazin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(trimethyl-λ4-sulfanyl)piperazin-1-yl]ethanone |
| PubChem CID | 123887418 |
| Molecular Formula | C9H20N2OS |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-[4-(trimethyl-λ4-sulfanyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(S(C)(C)C)CC1 |
| InChI | InChI=1S/C9H20N2OS/c1-9(12)10-5-7-11(8-6-10)13(2,3)4/h5-8H2,1-4H3 |
| InChIKey | LNLZUDLNZPZXTI-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[4-(trimethyl-λ4-sulfanyl)piperazin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(trimethyl-λ4-sulfanyl)piperazin-1-yl]ethanone?
The IUPAC name of 1-[4-(trimethyl-λ4-sulfanyl)piperazin-1-yl]ethanone (CID 123887418) is 1-[4-(trimethyl-λ4-sulfanyl)piperazin-1-yl]ethanone.
What is the SMILES notation for 1-[4-(trimethyl-λ4-sulfanyl)piperazin-1-yl]ethanone?
The canonical SMILES for 1-[4-(trimethyl-λ4-sulfanyl)piperazin-1-yl]ethanone is CC(=O)N1CCN(S(C)(C)C)CC1.
What is the InChIKey of 1-[4-(trimethyl-λ4-sulfanyl)piperazin-1-yl]ethanone?
The InChIKey is LNLZUDLNZPZXTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2OS/c1-9(12)10-5-7-11(8-6-10)13(2,3)4/h5-8H2,1-4H3.
What are the key properties of 1-[4-(trimethyl-λ4-sulfanyl)piperazin-1-yl]ethanone?
1-[4-(trimethyl-λ4-sulfanyl)piperazin-1-yl]ethanone has a molecular weight of 204.34 g/mol, XLogP of 0.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(trimethyl-λ4-sulfanyl)piperazin-1-yl]ethanone is sourced from PubChem (CID 123887418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).