C36H60N2O3 — CID 123887460
[3a-[2-(ethylamino)ethylcarbamoyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] acetate (PubChem CID 123887460) has the molecular formula C36H60N2O3 and a molecular weight of 568.89 g/mol. Its IUPAC name is [3a-[2-(ethylamino)ethylcarbamoyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] acetate.
| Compound Name | [3a-[2-(ethylamino)ethylcarbamoyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] acetate |
|---|---|
| PubChem CID | 123887460 |
| Molecular Formula | C36H60N2O3 |
| Molecular Weight | 568.89 g/mol |
| Exact Mass | 568.46 |
| IUPAC Name | [3a-[2-(ethylamino)ethylcarbamoyl]-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] acetate |
| SMILES | C=C(C)C1CCC2(C(=O)NCCNCC)CCC3(C)C(CCC4C5(C)CCC(OC(C)=O)C(C)(C)C5CCC43C)C12 |
| InChI | InChI=1S/C36H60N2O3/c1-10-37-21-22-38-31(40)36-18-13-25(23(2)3)30(36)26-11-12-28-33(7)16-15-29(41-24(4)39)32(5,6)27(33)14-17-35(28,9)34(26,8)19-20-36/h25-30,37H,2,10-22H2,1,3-9H3,(H,38,40) |
| InChIKey | UAHVZSOKRSGRKT-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.89 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|